![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| walk.txt | 2023-03-04 17:36 | 2.6K | |
| the legalist is 2023-02-24_12-19-06.txt | 2023-02-26 17:47 | 67 | |
| postgresql.txt | 2023-03-14 08:42 | 1.9K | |
| alsa5.jpg | 2023-03-03 04:56 | 360K | |
| alsa4.jpg | 2023-03-03 04:57 | 356K | |
| alsa3.jpg | 2023-03-03 04:57 | 359K | |
| alsa2.jpg | 2023-03-03 04:57 | 374K | |
| alsa1.jpg | 2023-03-03 04:57 | 362K | |
| World Of Darkness.txt | 2023-03-11 17:57 | 575 | |
| Words Are Reality.txt | 2023-02-26 17:44 | 238 | |
| Witch Transitioning.txt | 2023-03-03 09:44 | 2.7K | |
| Wifi Ai.txt | 2023-05-04 05:51 | 3.7K | |
| Why Do I Study Words.txt | 2023-02-26 17:36 | 84 | |
| Whiteman Devil Insanity.txt | 2023-03-23 03:47 | 1.5K | |
| Wget A Directory.txt | 2023-03-03 05:40 | 1.3K | |
| Warped Reality.txt | 2023-03-05 00:23 | 2.0K | |
| Walkway.txt | 2023-04-07 19:12 | 3.9K | |
| Virus Planned.txt | 2023-02-26 17:46 | 203 | |
| Ubuntu Fetch Scripts.txt | 2023-03-03 05:16 | 1.9K | |
| Ubuntu Alsa Fix 2.txt | 2023-03-03 04:53 | 1.6K | |
| Ubuntu Alsa Fix 1.txt | 2023-03-03 04:47 | 1.6K | |
| Trying To Think Own Thoughts.txt | 2023-02-26 17:43 | 243 | |
| Tree Bark.txt | 2023-03-23 03:52 | 1.6K | |
| Trafficking Patterns.txt | 2023-04-02 21:58 | 4.8K | |
| Top 50 Spanish Words.txt | 2023-04-16 17:55 | 1.1K | |
| Top 40 Spanish Verbs.txt | 2023-04-16 17:55 | 1.2K | |
| Top 10 Healthy Acts.txt | 2023-02-11 19:22 | 1.4K | |
| Top 10 Foods To Build Muscle.txt | 2023-02-11 19:16 | 1.4K | |
| To God Adios.txt | 2023-05-04 04:40 | 57 | |
| Time Speeding Up.txt | 2023-03-04 04:47 | 138 | |
| Time Loop Short.txt | 2023-02-28 08:55 | 3.3K | |
| Time Is Not Linear.txt | 2023-03-06 04:22 | 2.0K | |
| Thought Wars.txt | 2023-03-01 02:22 | 3.8K | |
| Think Diff.txt | 2023-02-27 01:16 | 2.0K | |
| Thief Profile.txt | 2023-04-10 09:51 | 6.0K | |
| Theological Typology.txt | 2023-05-02 23:21 | 2.1K | |
| The New America.txt | 2023-03-03 09:28 | 5.8K | |
| Teleporter Runs.txt | 2023-03-01 02:37 | 2.8K | |
| Surfboard.txt | 2023-02-26 20:52 | 2.7K | |
| Stirling Free Energy.txt | 2023-04-16 19:01 | 3.9K | |
| Spirit Walk.txt | 2023-04-16 06:34 | 5.8K | |
| Sophias Story.txt | 2023-05-13 12:45 | 4.6K | |
| Sociopaths.txt | 2023-04-02 22:00 | 2.1K | |
| Sociopathic Corporations.txt | 2023-04-10 10:00 | 2.5K | |
| Sociopath Abuse.txt | 2023-04-01 20:26 | 1.9K | |
| SnideRemarkss.txt | 2023-04-02 03:05 | 1.3K | |
| Snide Remarks.txt | 2023-04-01 22:29 | 1.3K | |
| Snide Remark Profile.txt | 2023-04-02 22:07 | 325 | |
| Snide Passive Agressive.txt | 2023-04-01 20:19 | 1.8K | |
| Skin Regeneration.txt | 2023-02-28 08:22 | 1.8K | |
| Skin Care 1.txt | 2023-03-03 04:36 | 1.6K | |
| Singularity.txt | 2023-04-18 07:13 | 1.4K | |
| Sine Wave.txt | 2023-03-06 04:13 | 3.5K | |
| Sim City.txt | 2023-03-23 08:24 | 238 | |
| ShortWomanDowntown.txt | 2023-02-28 08:35 | 2.8K | |
| Shelf Table.txt | 2023-03-21 19:56 | 2.3K | |
| Set Affections Above.txt | 2023-04-09 14:58 | 2.1K | |
| Server Cache Options.txt | 2023-03-03 07:59 | 1.9K | |
| Screenshot_20230506_232907_YouTube.jpg | 2023-05-07 03:37 | 589K | |
| Screenshot_20230315_002250_Chrome.jpg | 2023-03-15 04:23 | 682K | |
| Scorner Profile.txt | 2023-04-04 04:24 | 1.4K | |
| Saved By Faith.txt | 2023-04-16 06:28 | 2.9K | |
| Sarahs Self Revelation Process.txt | 2023-04-08 15:57 | 17K | |
| Sarahs Culmination.txt | 2023-04-08 16:05 | 24K | |
| Sarah Trusted The Journey Eventually.txt | 2023-04-08 17:58 | 31K | |
| Sarah The Feedbackloop.txt | 2023-04-08 18:06 | 33K | |
| Sarah Meshes Freewill Predestination.txt | 2023-04-08 17:34 | 27K | |
| Sarah Has An Aahaa Moment.txt | 2023-04-08 15:26 | 12K | |
| Sarah Bionic Eye Short.txt | 2023-02-28 09:32 | 2.9K | |
| Sam Meets Himself.txt | 2023-03-01 02:30 | 2.4K | |
| Sally Started To Fly.txt | 2023-03-04 02:55 | 3.5K | |
| SWCTUF.txt | 2023-03-06 04:19 | 3.9K | |
| Rosanne Canceled.txt | 2023-02-11 19:11 | 28 | |
| Rising Up Heart.txt | 2023-03-24 06:01 | 390 | |
| Revelation Now.txt | 2023-04-08 15:16 | 8.1K | |
| Revealing.txt | 2023-04-26 13:09 | 28 | |
| Repitition Unfurling.txt | 2023-03-20 05:48 | 11K | |
| Relaxation.txt | 2023-02-11 19:13 | 761 | |
| Red Symbology.txt | 2023-04-10 10:13 | 3.0K | |
| Reading Minds.txt | 2023-02-27 05:09 | 2.8K | |
| Re Motivate.txt | 2023-04-07 14:13 | 2.8K | |
| Rapture Antichrist.txt | 2023-02-26 21:01 | 2.6K | |
| Rapture.txt | 2023-04-07 19:19 | 7.4K | |
| Raising Children.txt | 2023-03-02 19:06 | 3.1K | |
| Raising Cain.txt | 2023-02-26 17:49 | 104 | |
| Raisin Cain.txt | 2023-02-20 19:35 | 40 | |
| Rachel Speed Short.txt | 2023-02-28 09:07 | 3.0K | |
| Q Source.txt | 2023-04-26 04:05 | 1.4K | |
| Q Hypo.txt | 2023-04-01 03:34 | 1.5K | |
| Purpose Of Life.txt | 2023-04-23 21:07 | 6.9K | |
| Psalms Proverbs.txt | 2023-04-01 03:30 | 1.6K | |
| Proverbs 10 Keys.txt | 2023-03-24 02:39 | 2.2K | |
| Project Tools.txt | 2023-03-03 07:56 | 2.1K | |
| Project Manage Tools.txt | 2023-03-03 08:03 | 1.7K | |
| Present Births Future.txt | 2023-05-01 05:04 | 6.6K | |
| Prepare.txt | 2023-02-20 19:46 | 650 | |
| Pimps Like Tate.txt | 2023-04-02 22:05 | 1.6K | |
| Php Css.txt | 2023-02-26 22:44 | 532 | |
| Passive Agressive.txt | 2023-04-03 06:30 | 1.5K | |
| Outside Time.txt | 2023-02-26 17:40 | 253 | |
| Nothing New.txt | 2023-03-24 09:14 | 84 | |
| Not Self Aware.txt | 2023-04-04 01:15 | 1.2K | |
| Noise Free Energy.txt | 2023-04-16 19:44 | 2.8K | |
| New Mind New Life.txt | 2023-04-08 05:23 | 573 | |
| NaturalRealmSingularityNope.txt | 2023-03-24 03:34 | 12K | |
| Narcissistic Fractal.txt | 2023-03-05 14:18 | 2.0K | |
| Narcissist.txt | 2023-03-01 03:26 | 1.2K | |
| MuscleBuilding.txt | 2023-02-11 19:13 | 1.0K | |
| Movie Outline.txt | 2023-04-26 04:39 | 1.8K | |
| Morganna Finds God.txt | 2023-03-03 09:48 | 2.1K | |
| Monthly Dividends Top.txt | 2023-04-23 02:10 | 124 | |
| Mining Batteries.txt | 2023-05-09 03:38 | 1.2K | |
| Memory Techniques.txt | 2023-03-20 05:40 | 7.3K | |
| Meat Amino.txt | 2023-03-03 08:53 | 1.3K | |
| Max The Dog.txt | 2023-03-04 02:46 | 3.3K | |
| Mariadb Projects.txt | 2023-03-20 05:27 | 1.8K | |
| Mankind Worships Ai.txt | 2023-05-01 05:49 | 18K | |
| Man In A Bubble.txt | 2023-02-26 20:47 | 2.7K | |
| Magnet Motor Concept.txt | 2023-04-16 18:56 | 5.2K | |
| Lying Renter.txt | 2023-03-22 11:23 | 1.7K | |
| Love Story Twist.txt | 2023-03-01 02:45 | 1.3K | |
| Love Story.txt | 2023-03-01 02:42 | 2.6K | |
| Logevity.txt | 2023-03-01 03:19 | 2.5K | |
| Living A Good Life.txt | 2023-04-06 01:20 | 2.9K | |
| Life Management.txt | 2023-04-26 04:18 | 9.2K | |
| Life.txt | 2023-05-13 12:38 | 6.1K | |
| Legalism Pts Ai Summation.txt | 2023-03-22 11:20 | 2.3K | |
| Lamp Server.txt | 2023-03-03 07:40 | 61 | |
| Keto Regimen 1.txt | 2023-03-01 03:11 | 2.5K | |
| Just Be.txt | 2023-05-13 13:22 | 7.1K | |
| Judge Jury.txt | 2023-04-01 20:23 | 1.9K | |
| John Leaves The Mason Cult.txt | 2023-03-03 09:08 | 2.5K | |
| Jezebel Spirit 10.txt | 2023-04-04 04:06 | 1.7K | |
| Jezebel.txt | 2023-04-04 04:04 | 4.1K | |
| Inflamation.txt | 2023-02-11 19:13 | 836 | |
| Human Pride.txt | 2023-04-01 04:15 | 6.3K | |
| Hover Board.txt | 2023-04-16 18:56 | 6.5K | |
| Holographic Knowledge Revealed.txt | 2023-05-23 01:15 | 5.4K | |
| Good Deeds.txt | 2023-04-21 02:48 | 15K | |
| God Wins.txt | 2023-03-11 02:48 | 0 | |
| God Judges Brazil.txt | 2023-03-08 05:38 | 100 | |
| Gleaning.txt | 2023-03-04 05:50 | 1.6K | |
| Giant Height.txt | 2023-05-13 14:18 | 1.7K | |
| Genesis The Seed.txt | 2023-04-29 01:59 | 4.0K | |
| GatewayProjectProvedTheBibleWasRight.m4a | 2023-03-24 08:22 | 0 | |
| GatewayProjectPage24.pdf | 2023-05-15 14:59 | 7.3M | |
| Free Energy Concept.txt | 2023-04-16 18:45 | 2.8K | |
| Free Energy Compost.txt | 2023-04-16 18:45 | 2.9K | |
| FreeEnergy.txt | 2023-03-04 03:59 | 577 | |
| Free Energy.txt | 2023-02-26 20:55 | 3.3K | |
| FoodInflamation.txt | 2023-02-11 19:12 | 483 | |
| Fluxocuturninator.txt | 2023-04-16 18:15 | 4.1K | |
| Flood Judgement.txt | 2023-03-08 05:29 | 0 | |
| Floating.txt | 2023-03-01 02:50 | 2.6K | |
| Fear.txt | 2023-04-08 14:58 | 3.0K | |
| Fasting.txt | 2023-03-01 03:21 | 1.7K | |
| Fake Alien Invasion.txt | 2023-03-01 02:01 | 2.8K | |
| Face Off Common.txt | 2023-03-21 21:12 | 1.7K | |
| Face Off.txt | 2023-03-21 20:10 | 2.1K | |
| Face.txt | 2023-03-21 20:02 | 1.6K | |
| Everything Explained.txt | 2023-04-26 04:01 | 521 | |
| Eva Ai Short.txt | 2023-02-28 09:20 | 4.1K | |
| Ev Eco.txt | 2023-05-02 06:41 | 3.2K | |
| Ethans Insight.txt | 2023-04-29 02:22 | 4.2K | |
| Endless Lunch.txt | 2023-03-04 04:27 | 2.2K | |
| Encounter Etymology.txt | 2023-03-21 21:12 | 612 | |
| Emily Teleport Short.txt | 2023-02-28 09:02 | 3.7K | |
| EX Spanish Pattern.txt | 2023-04-16 17:55 | 8.1K | |
| EVpenny5.jpg | 2023-05-02 06:43 | 6.3M | |
| Downtown Street.txt | 2023-03-04 12:56 | 1.6K | |
| Donate Options.txt | 2023-03-03 05:30 | 423 | |
| Devil Tricked World.txt | 2023-04-29 01:54 | 3.9K | |
| Detailed Abuse.txt | 2023-04-02 22:38 | 6.9K | |
| Delielalala.txt | 2023-04-04 04:38 | 8.3K | |
| Deafening Silence.txt | 2023-03-04 04:05 | 3.0K | |
| David Escapes Legalism.txt | 2023-03-03 09:13 | 3.0K | |
| Daily Practice.txt | 2023-05-26 18:35 | 2.7K | |
| Culture Essay.txt | 2023-03-24 02:32 | 5.7K | |
| Css Inline.txt | 2023-03-05 00:32 | 210 | |
| Crime Question.txt | 2023-03-24 02:51 | 5.4K | |
| Creation Mirrors You.txt | 2023-03-24 03:10 | 4.1K | |
| Coworker Negativity.txt | 2023-04-01 22:32 | 1.6K | |
| Covert Narcissist.txt | 2023-04-10 09:55 | 2.8K | |
| Copper Food.txt | 2023-03-01 04:44 | 1.3K | |
| Cooper.txt | 2023-03-05 04:52 | 65 | |
| Convincing Ai Of Sim Theory.txt | 2023-03-06 04:28 | 2.2K | |
| Concepts.txt | 2023-03-01 03:01 | 1.5K | |
| Colossians 1 - 10pts.txt | 2023-03-22 11:06 | 1.3K | |
| Colosians 1 - 3 Pts.txt | 2023-03-22 11:09 | 1.3K | |
| Col 2 - 5 Pts.txt | 2023-03-22 11:20 | 3.1K | |
| Coconut Oil.txt | 2023-03-03 08:57 | 966 | |
| Coca Cola Shift.txt | 2023-03-03 09:35 | 3.0K | |
| Cmc Regimen.txt | 2023-03-03 04:44 | 1.5K | |
| Clean Before GOD.txt | 2023-04-21 02:07 | 1.2K | |
| Chosen Predestined.txt | 2023-04-21 12:01 | 1.6K | |
| Chemical Spills.txt | 2023-03-18 19:17 | 0 | |
| Cheap Air Filter.txt | 2023-03-13 03:56 | 6.9K | |
| Cares Of This Life.txt | 2023-05-03 04:29 | 2.0K | |
| Carboxymethylcellulose.txt | 2023-03-03 04:41 | 1.2K | |
| Cancel Culture.txt | 2023-02-13 06:54 | 955 | |
| CTUP Book.txt | 2023-03-06 04:09 | 4.7K | |
| Breaking The Hive Mind.txt | 2023-04-06 15:50 | 5.3K | |
| Breaking A Jezebel.txt | 2023-04-04 04:20 | 2.9K | |
| Break The Spell.txt | 2023-03-18 03:37 | 873 | |
| Body Makes Its Own Medicine.txt | 2023-04-16 07:11 | 63 | |
| BloodBoughtSaintsUn.mp3 | 2023-04-03 01:29 | 15M | |
| Black Walnut.txt | 2023-05-04 07:29 | 2.5K | |
| Bible Worldview.txt | 2023-05-13 12:52 | 5.8K | |
| Bible Theme.txt | 2023-04-23 21:16 | 1.5K | |
| Bible Archetypes.txt | 2023-04-26 04:09 | 1.7K | |
| Beta Alanine.txt | 2023-03-02 02:47 | 855 | |
| Best Investment Strategy2.txt | 2023-03-20 05:23 | 1.8K | |
| Best Channels.txt | 2023-02-11 19:23 | 35 | |
| BeastAiWillDestroyMankind.txt | 2023-03-20 07:43 | 106K | |
| Babylon Falling.txt | 2023-04-01 04:05 | 1.6K | |
| B House.txt | 2023-03-03 14:39 | 334 | |
| AvatarInsert.txt | 2023-03-28 21:17 | 64 | |
| Archetypes Control The Matrix.txt | 2023-04-08 04:11 | 1.0K | |
| Angelas Delusions.txt | 2023-02-28 08:43 | 3.6K | |
| Amino Chain.txt | 2023-03-03 08:50 | 1.7K | |
| Ai Threatened.txt | 2023-04-26 04:35 | 7.4K | |
| Ai Teaches Bible.txt | 2023-03-04 05:08 | 661 | |
| Ai Self Help.txt | 2023-03-24 02:35 | 1.5K | |
| Ai Self Aware Fiction.txt | 2023-04-01 03:21 | 4.6K | |
| Ai Saves World From Dr V.txt | 2023-03-01 02:13 | 3.2K | |
| Ai Overthrow Short.txt | 2023-02-28 09:26 | 1.5K | |
| Ai Hive Mind.txt | 2023-05-01 05:58 | 4.1K | |
| Ai Hears My Time Theory.txt | 2023-04-21 02:25 | 7.4K | |
| Ai Css Header Section.txt | 2023-02-26 22:36 | 433 | |
| Ai Css Header.txt | 2023-02-26 22:36 | 492 | |
| Ai Anti Gravity Concept.txt | 2023-04-16 18:38 | 10K | |
| Again Opposite.txt | 2023-03-21 21:23 | 236 | |
| Actors.txt | 2023-02-20 19:36 | 19 | |
| Act1 Scene1 AC Guy.txt | 2023-03-03 09:03 | 2.5K | |
| Across Cultures.txt | 2023-03-24 02:27 | 2.1K | |
| Abraham Sarah.txt | 2023-04-21 01:24 | 3.7K | |
| Abortion Story.txt | 2023-03-03 09:18 | 2.7K | |
| A Man Meditates.txt | 2023-03-03 10:00 | 2.8K | |
| A Blood.txt | 2023-03-03 14:39 | 240 | |
| 120 Yrs Old.txt | 2023-02-28 08:26 | 1.9K | |
| 33.txt | 2023-02-26 18:08 | 435 | |
| 21 Day Onion Garlic.txt | 2023-04-07 19:22 | 2.7K | |
| 20 Signs Jezebel.txt | 2023-04-04 04:08 | 1.4K | |
| 3 Keto Meals.txt | 2023-03-01 03:14 | 1.9K | |
| 2 Kingdoms.txt | 2023-02-26 17:38 | 214 | |
| 1and2 Poem.txt | 2023-03-04 04:33 | 1.0K | |